On Target AA2BR_HUMAN 0.38914028/CHEMBL4069458
For the given ligand Cilostazol, we have found in our database that, being scored 0.38914028, the most similar ligand is CHEMBL4069458. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL4069458 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | CCCN1C(=O)N(CCC)c2nc([nH]c2C1=O)c3ccc(OCC4CN(C(=O)C4)c5ccc(F)cc5)cc3 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 0406c02a 00801808 20180108 12010700 21181060 0200e050 02049200 00080400 16400100 900018e0 0c28800c 40019800 06809022 00d01000 112a00c1 080c300c 00a40000 0200a100 08c00000 00620201 c0100100 38100650 218020c1 0070001c 00040001 c0200000 60020200 10040081 0000c205 00468c01 c0080800 40800ac8 |