On Target ADRB2_HUMAN 0.4524887/CHEMBL327519
For the given ligand Cilostazol, we have found in our database that, being scored 0.4524887, the most similar ligand is CHEMBL327519. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL327519 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | CCCCCCCCNC(=O)Nc1ccc(cc1)S(=O)(=O)N2CCC(CNC[C@H](O)COc3ccc(O)c4NC(=O)CCc34)CC2 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 04004016 c3803208 21100108 01b10e00 30081090 c6002040 06000004 20002209 00200810 004808c0 08382024 70039040 04809002 08100001 816a0041 000c6008 1024a080 22408000 08c02008 00026601 c0100100 18050610 27022080 18508418 02110801 c1000004 20080050 108010cc 00008700 2006800b 000a0400 22036670 |