On Target CCR4_HUMAN 0.38190955/CHEMBL499852
For the given ligand Cilostazol, we have found in our database that, being scored 0.38190955, the most similar ligand is CHEMBL499852. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL499852 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | COc1cc2nc(nc(NCCCc3ccc(Cl)cc3)c2cc1OC)N4CCC(CC4)N5CCCC(CO)C5 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 0001c002 01000609 20100108 08090600 220c1008 00006000 0608a000 20100888 00000900 200809e0 09300004 50019800 06004026 01400000 01020041 000c800c 00040000 02004008 08e00000 00a60601 40100100 1c040128 218048c0 00700010 00002001 80000000 00040000 100000c0 00008218 0046081a 40001000 002a26c0 |