On Target 5HT1D_HUMAN 0.5202312/CHEMBL1112
For the given ligand Cilostazol, we have found in our database that, being scored 0.5202312, the most similar ligand is CHEMBL1112. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL1112 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | Clc1cccc(N2CCN(CCCCOc3ccc4CCC(=O)Nc4c3)CC2)c1Cl |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 0400c002 80000208 20100128 05010700 30101000 06002040 0a040000 28000000 00000800 00080ac0 08380024 40009800 06808006 08102001 11020041 000c2008 00048080 12000000 08400008 00026601 40100100 38000700 21002021 02410012 00002800 81100400 00120210 10001080 08008200 0006000b 00000000 20020e00 |