On Target CCR5_HUMAN 0.43956044/CHEMBL402242
For the given ligand Cilostazol, we have found in our database that, being scored 0.43956044, the most similar ligand is CHEMBL402242. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL402242 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | COc1ccc(NC(=O)N(CCCN2[C@@H]3CC[C@H]2C[C@H](C3)n4c(C)nnc4C(C)C)c5ccccc5)cc1 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 00004006 01001408 60100008 00000e40 21081000 00000014 06800004 20002209 00200100 100409e0 00288104 52018800 00009026 01900000 01020041 0008200c 00148000 00400000 08402000 00260201 60100100 18492410 21022000 00500418 00110000 40000200 00040004 10011080 00008204 00060011 80120080 20006200 |