On Target CCR1_HUMAN 0.5159575/CHEMBL3099952
For the given ligand Cilostazol, we have found in our database that, being scored 0.5159575, the most similar ligand is CHEMBL3099952. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL3099952 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | O[C@H](COc1cccc2CCC(=O)Nc12)CN3CCC4(CC3)Cc5cc(Cl)ccc5O4 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 0400d002 47000208 2010010a 00010600 a00010c0 42002040 06000000 20000240 00110820 000808c0 083c0024 50019840 06808006 20300080 812e0041 000c6418 18248000 22008400 0c880008 00020201 40100100 18000700 27402080 08548010 00002801 81000000 20100050 10801080 00008300 0006400b 00000400 20022640 |