On Target TAAR1_HUMAN 0.4331551/CHEMBL1333283
For the given ligand Cilostazol, we have found in our database that, being scored 0.4331551, the most similar ligand is CHEMBL1333283. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL1333283 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | Cl.COc1cc(ccc1O)C(N2CCc3ccccc3C2)c4nnnn4C5CCCC5 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 0000000a 47000018 60700108 10010e00 30081020 00000008 06000000 22083601 00000080 101808c0 08218000 40018000 00005886 20a00000 41000601 0008a00c 00002200 02000820 00480000 00860201 00060001 18218010 01004000 81548410 00050000 c0000000 00324000 90000000 04000304 01060002 a60c0000 08020603 |