On Target DRD2_HUMAN 0.5786164/CHEMBL2165124
For the given ligand Cilostazol, we have found in our database that, being scored 0.5786164, the most similar ligand is CHEMBL2165124. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL2165124 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | CCOc1ccc(cc1)N2CCN(CCCCOc3ccc4CCC(=O)Nc4c3)CC2 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 04004002 80000208 20100128 04010700 30101000 06002040 02040000 20000008 00000800 00080ac0 08380024 40009000 04808022 08102000 11020041 000c2008 00048080 02000000 08400008 00022601 40100100 38000600 21002021 02400012 00000800 81000000 00160210 10001080 08008200 0006000b 00000000 20020e00 |