On Target 5HT5A_HUMAN 0.36708862/CHEMBL278751
For the given ligand Cilostazol, we have found in our database that, being scored 0.36708862, the most similar ligand is CHEMBL278751. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL278751 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | CCCN(CCC)[C@@H]1CCc2c(OC)cccc2[C@@H]1C |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 00000000 43000208 2010010a 00010600 00001020 c0000002 02000000 20000201 00000880 000808c0 08300000 40808040 00000002 20200000 01000001 02042008 00000200 02000000 00082000 00020201 00000100 18200000 00004000 81400410 00000000 c0000001 00000000 10000000 04000302 0006c00a 00000000 00002600 |