On Target HRH3_HUMAN 0.5771812/CHEMBL210252
For the given ligand Cilostazol, we have found in our database that, being scored 0.5771812, the most similar ligand is CHEMBL210252. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL210252 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | C(COc1ccc2N(CC3CCCCC3)CCCc2c1)CN4CCCCC4 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 04004002 43000208 20100108 00010600 20001000 42002040 02000000 20000008 00000800 000808c0 08300004 50018000 00800022 20000080 01020041 000c200a 00248000 02000000 0a882008 00020201 40100100 18000010 21000080 00500010 00000001 81000000 00040000 10001080 00088200 0006000a 00020080 20002640 |