On Target NK1R_HUMAN 0.46745563/CHEMBL1817896
For the given ligand Cilostazol, we have found in our database that, being scored 0.46745563, the most similar ligand is CHEMBL1817896. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL1817896 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | COc1ccc(NC(=O)C)cc1CN2CCC(=O)C(C2)C(c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 10004002 01000208 6010010a 00010600 04001000 08000100 02000000 23001408 00800800 001808d0 08380004 50019000 0c008822 00300000 01000441 00042008 00040000 02000000 08002018 00020201 40100100 18008610 20002000 00500010 00041800 e0000000 00040000 d0000080 00408382 0006000b 24040000 00002600 |