On Target AA1R_HUMAN 0.38636363/CHEMBL17341
For the given ligand Cilostazol, we have found in our database that, being scored 0.38636363, the most similar ligand is CHEMBL17341. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL17341 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | CCCN1C(=O)N(CCC)c2[nH]c(nc2C1=O)c3ccc(OCC(=O)Nc4ccccc4C(=O)C)cc3 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 1400e02a 00801808 20181108 12010702 000810e0 0001c040 02049200 00080500 16c00100 900818e0 0c2c802c 4001c800 02809022 00d01000 012a10c1 080c100c 00848000 8200a000 08400000 00420000 c0100100 38060650 33802041 00700014 00040000 c0200000 68020018 00041080 0008c205 00460c03 c0080800 60000688 |