On Target CXCR3_HUMAN 0.42196533/CHEMBL3697093
For the given ligand Cilostazol, we have found in our database that, being scored 0.42196533, the most similar ligand is CHEMBL3697093. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL3697093 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | COc1cc(CN(C[C@@H]2CC[C@H](CC2)C(=O)O)[C@@H](C)c3ccc(Cl)cc3)ccc1CCCN4C(=O)CCC4=O |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 00038000 45001208 20100108 00010600 00081000 00000010 02000000 22001200 00000900 000808c0 08300000 40019840 8600886e 00800000 01000401 000c2008 00002000 02000000 02482000 00020201 00020100 18048f10 01000000 00548418 00002000 c0000000 00040000 90000000 00000302 0006800b 20060000 00822600 |