On Target CNR1_HUMAN 0.5081081/CHEMBL138667
For the given ligand Cilostazol, we have found in our database that, being scored 0.5081081, the most similar ligand is CHEMBL138667. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL138667 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | CC1=CC[C@@H]2[C@@H](C1)c3c(O)cc(cc3OC2(C)C)C(C)(C)CCCCC(=O)Nc4ccc(Cl)cc4 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 0401c003 c3000018 2010010a 80110700 20081000 c2002000 42000000 00000602 00000900 001808ca 08380004 40019840 0682800e 20b00080 11020441 00082008 00840000 22008020 08482000 00022a01 40100100 18000710 2100a040 00500410 00202000 c0002000 04484000 90000080 00018302 00074003 24020000 02030600 |