On Target PTAFR_HUMAN 0.39170507/CHEMBL155975
For the given ligand Cilostazol, we have found in our database that, being scored 0.39170507, the most similar ligand is CHEMBL155975. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL155975 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | CCCOc1c(NC(=O)N(O)C2CCCCC2)cc(cc1OC)C3CCC(O3)c4cc(OC)c(OC)c(OC)c4 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 04002007 cb001018 e010010a 00210e00 94081010 42004008 46040004 00002001 00410900 000808d8 083c0004 48018000 0080d006 28310800 01080045 0208e418 00040100 0a400204 0a492000 c0062e01 44000120 18050430 21422000 00510018 00150c00 80002000 205a0040 10000080 00428202 0006000f 40080000 02024640 |