On Target GRM5_HUMAN 0.36956522/CHEMBL206427
For the given ligand Cilostazol, we have found in our database that, being scored 0.36956522, the most similar ligand is CHEMBL206427. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL206427 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | CN(C(=O)Cc1c(F)cccc1F)c2cc(C)cc(OCc3cccc(Cl)c3)c2 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 0400c002 d0800008 60100108 02010600 34001400 04004010 06000000 00040000 00000100 00090850 08280004 c0009800 03808006 08111080 c1020041 02080008 01040280 02000000 08080000 00022600 40100000 18200720 20002000 81c01011 00042000 80002000 00000000 00000081 04c08200 00068003 40002000 00020600 |