On Target CLTR1_HUMAN 0.5026178/CHEMBL3403185
For the given ligand Cilostazol, we have found in our database that, being scored 0.5026178, the most similar ligand is CHEMBL3403185. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL3403185 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | OC(=O)CCCN1CC(Oc2c(CCc3ccc(OCCCCc4ccccc4)cc3)cccc12)c5nnn[nH]5 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 04026002 01000018 6032110a 00010702 b0181080 82002048 02040000 20082200 00400a00 000808d0 08348004 400090c0 04808082 00204800 110a1041 0008600e d0850800 0a028800 08442000 00020201 45160100 18140a00 b3400000 00408410 00040000 c0000000 28120000 10000081 00408304 00060002 80000400 08802f00 |