On Target GRM3_HUMAN 0.455/CHEMBL1630807
For the given ligand Cilostazol, we have found in our database that, being scored 0.455, the most similar ligand is CHEMBL1630807. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL1630807 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | COc1ccc(NC(=O)C23CC2\C(=N/O)\c4ccccc4O3)cc1 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 04016003 01000038 6390110a 00050f02 20481080 82003000 02000140 1000620a 00110940 000908c1 083d0004 4001d040 0484802a 01300000 11021049 00082018 00840000 a2028000 08406000 00020001 40140100 18060610 33002040 00500410 00000000 c0000000 48240008 12000080 0004830b 00064003 40080000 00440601 |