On Target 5HT1E_HUMAN 0.34031415/CHEMBL105261
For the given ligand Cilostazol, we have found in our database that, being scored 0.34031415, the most similar ligand is CHEMBL105261. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL105261 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | CCC(=O)Nc1ccc2[nH]cc(C3CCN(C)CC3)c2n1 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 00004002 01800a00 00184180 40810610 200c1240 00000000 0000a000 20100000 00400800 200800c0 08380004 5001b000 08008802 00500800 00060840 00040004 08040000 02004008 08600400 00a00205 40100100 5c008608 21802840 80700010 00042000 80000000 08008080 10000084 00008008 0006180b 00041200 00000720 |