On Target TSHR_HUMAN 0.45061728/CHEMBL3908443
For the given ligand Cilostazol, we have found in our database that, being scored 0.45061728, the most similar ligand is CHEMBL3908443. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL3908443 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | CCCCCC(=O)Nc1ccc2N(C(=O)C)C(C)(C)CC(C)(c3ccccc3)c2c1 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 08014002 01001200 40100102 00010600 24000020 00082040 01000000 21000000 00400800 000808d0 08380024 40019000 0400800a 00300800 00020040 00040000 00048000 02000001 08002008 00000201 44100100 18040610 20002000 00500018 00040000 a1000000 00000010 50001080 00488080 0006000b 00000080 20000600 |