On Target 5HT1B_HUMAN 0.48369566/CHEMBL2424668
For the given ligand Cilostazol, we have found in our database that, being scored 0.48369566, the most similar ligand is CHEMBL2424668. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL2424668 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | Cl.FCCOc1cc(OC2CCNCC2)ccc1CC(=O)N3CCC(CC3)N4C(=O)CCc5ccccc45 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 04804003 01001608 20100108 00010600 20001000 82002040 42040000 29000200 00000880 000809e0 08380024 50019080 05808002 00100000 41020041 000c200a 90248000 02008004 08800408 00020a01 60100100 182c0600 21002080 81500018 00000801 c1000400 00120010 10001080 04098300 0006001b 00002080 20022640 |