On Target GRM2_HUMAN 0.49101797/CHEMBL187959
For the given ligand Cilostazol, we have found in our database that, being scored 0.49101797, the most similar ligand is CHEMBL187959. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL187959 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | CCCc1c(O)c(ccc1OCCCCNc2ccc(cc2)c3nn[nH]n3)C(=O)C |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 04004003 00000818 60100109 00010700 20101001 82022008 42040000 00080200 00000800 00080ac0 08310004 40008040 00808082 00008000 11020041 0808200c 00040000 22008800 08400000 00020801 40160100 18020200 21008000 00404414 00000000 c0200000 10120200 10800080 00018304 00060002 80000200 08000e00 |