On Target CXCR4_HUMAN 0.34920636/CHEMBL2179709
For the given ligand Cilostazol, we have found in our database that, being scored 0.34920636, the most similar ligand is CHEMBL2179709. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL2179709 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | NC(=N)NCCC[C@@H]1NC(=O)[C@H](Cc2ccc(NC(=N)N)cc2)NC(=O)[C@@H](Cc3ccc(O)cc3)NC(=O)CNC(=O)[C@H](Cc4ccc5ccccc5c4)NC1=O.OC(=O)C(F)(F)F |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 00010002 01003a18 20100100 44010e00 00000000 00000000 02000000 2000200d 00200a80 000808c2 08300004 4003b000 06009012 0000a001 80000040 001c0008 00040000 02000000 08000008 00020205 40020100 38250e28 20000003 83500018 00100800 80000000 40120000 90000080 0c008010 0006000b a0084000 04006600 |