On Target CCKAR_HUMAN 0.41904762/CHEMBL316104
For the given ligand Cilostazol, we have found in our database that, being scored 0.41904762, the most similar ligand is CHEMBL316104. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL316104 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | COc1ccc(cc1)N(C(C)C)C(=O)CN2C(=O)C(C)(Cc3nn(C)c4ccccc34)C(=O)N(c5ccccc5)c6ccccc26 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 00004006 00002608 20100129 04010600 210c5000 00002002 02000030 20300208 00002900 000c0be0 0838a004 7001b040 0e008022 00502000 81060041 000c200c 00240000 16804000 0860001a 10220241 60100100 3c010618 24802801 0260041a 00103800 c0000080 02160020 10008180 08008304 0206801b 20005000 00004620 |