On Target AA3R_HUMAN 0.38679245/CHEMBL80
For the given ligand Cilostazol, we have found in our database that, being scored 0.38679245, the most similar ligand is CHEMBL80. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL80 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | Oc1ccc2C[C@H]3N(CC=C)CC[C@@]45[C@@H](Oc1c24)C(=O)CC[C@@]35O |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 04051000 43000208 2010050a 00210700 001810e1 c2000002 07001000 20008641 00050880 010818c0 08340000 d081d140 0480c01a 22a10080 110c0021 020ca018 18800200 a2008100 07482008 00020201 00000100 18200210 03004040 83500410 00000800 c0000001 001a0208 10000000 04000302 0006c80a 04020000 02002e40 |