On Target GRM4_HUMAN 0.4090909/CHEMBL2063423
For the given ligand Cilostazol, we have found in our database that, being scored 0.4090909, the most similar ligand is CHEMBL2063423. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL2063423 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | O\N=C\1/[C@@H]2C[C@@]2(Oc3ccccc13)C(=O)Nc4ccccn4 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 04016003 01000038 6398710a 00050f02 204c1080 82003000 02000140 10106202 00110940 200908c1 083d0004 4001d040 0484980a 01300000 11021009 000c201c 00840000 a202c000 08606000 00a20001 40140100 1c068610 33802840 00700410 00000000 c0000000 48200088 12000080 0004830b 00064803 40081000 00440701 |