On Target CCR2_HUMAN 0.3857143/CHEMBL2204247
For the given ligand Cilostazol, we have found in our database that, being scored 0.3857143, the most similar ligand is CHEMBL2204247. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL2204247 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | COc1cccc(n1)[C@@]2(O)CC[C@H](CC2)N3CC(C3)NC(=O)CNC(=O)c4cccc(c4)C(F)(F)F |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 0000800a 01022818 20b0410a 14010600 801c1021 00004100 15000400 22001008 00100b00 000908d0 08308004 4081a002 02008882 01a02000 23020501 0a1c000c 50008000 06800000 02602008 00020201 40320100 38028630 21800003 0250001c 00000000 c0000000 08000040 90000080 08000306 00860003 f0164000 24002e00 |