On Target AA2BR_HUMAN 0.2712766/CHEMBL3317575
For the given ligand THC, we have found in our database that, being scored 0.2712766, the most similar ligand is CHEMBL3317575. Check out the elaboration below.
| THC (Given Ligand) | CHEMBL3317575 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)[C@@H]3CC/C(C)=C\[C@@H]23 | COc1ccccc1CCCc2nc(N)c3nn(cc3n2)c4ccccc4 |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 0000000e 81800208 2008150a 18090620 01081060 0000c000 07009010 00001a00 10100900 000d18c0 09108004 40819040 00000802 00a00000 010200c1 020c200c 10000000 06000008 01600008 00260401 c0000100 18018060 25800840 83400410 00100000 c0000000 08010000 00000880 0400030c 00c6480a 40040000 a02405e0 |