On Target BKRB2_HUMAN 0.21681416/CHEMBL553530
For the given ligand THC, we have found in our database that, being scored 0.21681416, the most similar ligand is CHEMBL553530. Check out the elaboration below.
| THC (Given Ligand) | CHEMBL553530 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)[C@@H]3CC/C(C)=C\[C@@H]23 | Cl.CNC(=O)c1ccc(\C=C\C(=O)NCC(=O)N(C)c2ccc(Cl)c(COc3cccc4c(OC5CCCC5)cc(C)nc34)c2Cl)cc1 |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 0400c002 4100a808 60004128 54010700 040c1020 06004024 82900080 0a201408 01800100 00400a50 00280804 4004a800 82808806 08512480 11020043 020c200c 20841400 12000104 08698000 80861001 41101000 28028728 21802000 82c1901e 00042400 80082602 00482240 c0010080 08428304 01060001 e4044000 02260200 |