On Target 5HT5A_HUMAN 0.21794872/CHEMBL3938006
For the given ligand Ginkgo C, we have found in our database that, being scored 0.21794872, the most similar ligand is CHEMBL3938006. Check out the elaboration below.
| Ginkgo C (Given Ligand) | CHEMBL3938006 (Similar Ligand) |
|---|---|
| [H][C@]12OC(=O)[C@H](O)C15C[C@@H](O)[C@@]4([H])OC(=O)C6(O2)[C@@]3(O)[C@H](C)C(=O)O[C@@]3([H])[C@H](O)C456 | CN(C)c1nc(Cl)nc2c1ncn2[C@H]3[C@H](O)[C@H](O)[C@@]4(C[C@H]34)C(=O)O |
|
|
|
|
|
|
| 00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 082a9008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 | 0007800a 05801800 80080000 08080620 00380060 0000c000 00008000 00000800 00400100 00800080 0020800c 40011000 17009038 03800000 c0080480 100cc00c 00040000 00004080 0bc02000 80202001 80000400 10040b50 27804044 04000014 00000002 00000200 00000400 000000b0 00020008 01460000 c00a2000 000200c0 |