On Target CLTR1_HUMAN 0.19117647/CHEMBL22776
For the given ligand Ginkgo C, we have found in our database that, being scored 0.19117647, the most similar ligand is CHEMBL22776. Check out the elaboration below.
| Ginkgo C (Given Ligand) | CHEMBL22776 (Similar Ligand) |
|---|---|
| [H][C@]12OC(=O)[C@H](O)C15C[C@@H](O)[C@@]4([H])OC(=O)C6(O2)[C@@]3(O)[C@H](C)C(=O)O[C@@]3([H])[C@H](O)C456 | O[C@H]([C@H](SCCC(=O)O)c1ccccc1CCCCCCCCc2ccccc2)C(=O)O |
|
|
|
|
|
|
| 00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 082a9008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 | 00000012 01008000 0002252a 00110200 00080040 00000002 01001000 00000001 00400800 00084840 08101000 4000d000 04019100 40240000 00040020 00080108 2c000008 02000100 00402008 00400001 00000100 08000a00 05004640 00400010 00048a00 80000011 00000000 00000000 00001002 00020822 00020000 05010400 |