On Target CNR2_HUMAN 0.39/CHEMBL1800732
For the given ligand Ginkgo C, we have found in our database that, being scored 0.39, the most similar ligand is CHEMBL1800732. Check out the elaboration below.
| Ginkgo C (Given Ligand) | CHEMBL1800732 (Similar Ligand) |
|---|---|
| [H][C@]12OC(=O)[C@H](O)C15C[C@@H](O)[C@@]4([H])OC(=O)C6(O2)[C@@]3(O)[C@H](C)C(=O)O[C@@]3([H])[C@H](O)C456 | CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCCOC(CO)COC(=O)CCCC#C |
|
|
|
|
|
|
| 00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 082a9008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 | 00010042 01000000 00000508 00010300 00482040 00000000 08008000 00000442 00002000 01100008 00000080 40009000 04028000 00000000 00000400 00089008 00820000 00000000 01402000 00020001 00000029 00000a00 05008000 08000810 00200400 00000000 00404000 80000020 00000200 00000008 24000800 00000000 |