On Target 5HT4R_HUMAN 0.20707071/CHEMBL1632169
For the given ligand Ginkgo C, we have found in our database that, being scored 0.20707071, the most similar ligand is CHEMBL1632169. Check out the elaboration below.
| Ginkgo C (Given Ligand) | CHEMBL1632169 (Similar Ligand) |
|---|---|
| [H][C@]12OC(=O)[C@H](O)C15C[C@@H](O)[C@@]4([H])OC(=O)C6(O2)[C@@]3(O)[C@H](C)C(=O)O[C@@]3([H])[C@H](O)C456 | CC(C)(C)C(=O)OCOC(=O)CCCCCN1CCC(CNC(=O)c2c3OCCCn3c4ccccc24)CC1 |
|
|
|
|
|
|
| 00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 082a9008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 | 14010002 01801818 60100108 00010f10 800c1030 02020100 06084800 2a003404 00210200 009008e0 09240004 50039020 0480980e 00c00000 21020541 023c200c 10a20008 a2808000 40e0a000 00060201 c0020040 18078e18 21800000 8050001c 00044000 c0000000 48000a00 b4000000 01000300 00060001 a42c8200 84002260 |