On Target V1AR_HUMAN 0.23076923/CHEMBL41547
For the given ligand D9-1, we have found in our database that, being scored 0.23076923, the most similar ligand is CHEMBL41547. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL41547 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | CC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H]2CCCNC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](Cc3c[nH]c4ccccc34)NC(=O)[C@@H](CC5CCCCC5)NC(=O)[C@@H]6CCCN6C2=O |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 00010002 01003a00 00100100 45810e10 00041202 00000010 00012000 2000000c 00600880 000908c2 08300014 4003b000 1e00881a 00402809 80000040 00040004 00000800 02000000 02202408 00000201 40000100 38248638 20800003 93500018 00043800 80000000 48010000 10000000 0c000000 0006000b 20064200 00002620 |