On Target ADRB2_HUMAN 0.25833333/CHEMBL15988
For the given ligand D9-1, we have found in our database that, being scored 0.25833333, the most similar ligand is CHEMBL15988. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL15988 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | C1CC(CCN1)c2c[nH]c3ccccc23 |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 00000002 01000a00 00100100 40810610 00041200 00000000 00002000 20000000 00400800 000808c0 08300004 50018000 08000802 00400800 00000040 00040004 00000000 02000000 00200400 00000201 40000100 18008008 20800000 80400010 00042000 80000000 08000000 10000000 00000000 0006000a 00040200 00000620 |