On Target CCR4_HUMAN 0.20731707/CHEMBL207780
For the given ligand D9-1, we have found in our database that, being scored 0.20731707, the most similar ligand is CHEMBL207780. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL207780 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | Cc1cccc(Nc2cccc(CN(CC3CCCCC3)Cc4ccccc4C(F)(F)F)n2)c1C |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 00000202 01000000 00104100 10010e00 01040020 00100000 00800410 22003041 00002900 000808d0 00210004 40018800 00000802 01200000 00020440 020c0104 00042000 12004002 0a202002 10a00201 45020000 1c01a010 21800800 00700010 00140000 c0000000 020040c0 90011080 0040810c 00260800 60160000 00004202 |