On Target GABR1_HUMAN 0.1633987/CHEMBL392394
For the given ligand D9-1, we have found in our database that, being scored 0.1633987, the most similar ligand is CHEMBL392394. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL392394 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | CSc1nc(NC2CCCC2)c(c(NC3CCCC3)n1)[N+](=O)[O-] |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 00014002 01000110 00180220 08182620 20000000 00006000 00009800 00100900 14000100 000000a0 00200004 40011000 04010101 00000000 00060000 000c0014 04141040 04004000 00400000 80200001 00120200 18040000 20804040 00980010 00080004 90500000 40040400 10000080 00084008 01460000 40001000 080102c0 |