On Target NPSR1_HUMAN 0.22988506/CHEMBL1801269
For the given ligand D9-1, we have found in our database that, being scored 0.22988506, the most similar ligand is CHEMBL1801269. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL1801269 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | Brc1ccc(cc1)C2(Cc3cccnc3)c4ccccc4c5nccn25 |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 00004102 0080c200 10104100 11810610 200c1060 00002000 00002400 01081000 80500900 100918c0 0810800c 40018000 01001810 00a00800 00820080 020d0004 00000000 0e002c04 00680400 00400001 c0100100 38108000 21c05040 89400011 00040000 e0000001 08120000 50014080 06400084 0046080a 400c0808 08000500 |