On Target NK2R_HUMAN 0.27096775/CHEMBL307338
For the given ligand D9-1, we have found in our database that, being scored 0.27096775, the most similar ligand is CHEMBL307338. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL307338 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | CN(CC(CCN1CCC(O)(CC1)c2ncc[nH]2)c3ccc(Cl)c(Cl)c3)C(=O)c4ccccc4 |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 0000800a 05001a00 00100500 10010600 00000040 00000000 04000020 22001004 00200b80 000808c0 08308000 50038800 02008826 00000000 80020400 000c000c 00008000 06800000 00800008 00000201 20000100 18268700 21000084 815c001c 00002001 c0100000 00040000 90000100 04000104 00c6080b e0040000 20022600 |