On Target ADRB3_HUMAN 0.2754491/CHEMBL1085929
For the given ligand D9-1, we have found in our database that, being scored 0.2754491, the most similar ligand is CHEMBL1085929. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL1085929 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | Cn1c(CCC(=O)Nc2ccc(CCNC[C@H](O)c3cccnc3)cc2)nc4ccccc14 |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 0000400a 00004c00 00105500 51010610 200410e0 00006000 00002020 00000000 00400180 000918c0 0928800c 50819000 04009802 00508000 000a0040 020c000c 10040000 06000004 08600418 00000201 e0100000 18208670 23802001 91400414 00041000 c0000000 08000000 10000180 04408004 00c60803 c0000000 20002680 |