On Target ACM4_HUMAN 0.27419356/CHEMBL1201353
For the given ligand D9-1, we have found in our database that, being scored 0.27419356, the most similar ligand is CHEMBL1201353. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL1201353 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | CN(C)CC[C@@H](c1ccc(Cl)cc1)c2ccccn2 |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 0000800a 00000200 00104100 10010600 00040020 00080000 00000020 01001000 00000800 000808c0 08308004 40808800 02000824 00000000 00020000 02040084 00000000 06000001 00200008 00000001 60000100 18008100 20800000 00400010 00002000 a0000000 00040040 50000100 00000084 0086000a 00000000 20020600 |