On Target TAAR1_HUMAN 0.3006993/CHEMBL1541237
For the given ligand D9-1, we have found in our database that, being scored 0.3006993, the most similar ligand is CHEMBL1541237. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL1541237 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | O=C(NCN1CCc2ccccc2C1)c3cnccn3 |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 1000000a 01800000 00100900 10010e10 00000060 00100000 0000c004 02007003 10000080 00080840 09290000 40008000 00009882 00300000 00820400 00040104 08044208 02000020 00000040 00000201 80020100 18218e00 21004000 81400118 00150000 c0000000 08000000 80000004 04001104 00060803 a0040000 80000600 |