On Target ADA1D_HUMAN 0.3053435/CHEMBL511411
For the given ligand D9-1, we have found in our database that, being scored 0.3053435, the most similar ligand is CHEMBL511411. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL511411 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | Fc1ccccc1C2Cc3nccn3C2 |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 0200000a 00000200 10101500 12010600 00080640 00000010 00000000 00040000 00100980 000818c0 08108008 40018000 00001000 00801000 00820080 000c0004 01000200 06000000 00400008 00000001 a0000100 18000010 29000000 81400410 00000800 c1000020 00000000 10000101 04000004 00c6880a 40080000 20000600 |