On Target 5HT5A_HUMAN 0.2651515/CHEMBL270840
For the given ligand D9-1, we have found in our database that, being scored 0.2651515, the most similar ligand is CHEMBL270840. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL270840 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | CCCC1NC(=Nc2ccccc12)N |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 00000042 01000000 00100102 00010e00 00000000 00100000 01000000 02003000 00000a00 000808d2 19300004 44008020 00001800 40200008 000200c0 00100018 00000800 02000004 01000008 00000001 40002100 18018000 22000010 00400010 00080000 88000000 40000000 90000800 00000110 00860002 800c0020 e0000700 |