On Target NK1R_HUMAN 0.2760736/CHEMBL393746
For the given ligand D9-1, we have found in our database that, being scored 0.2760736, the most similar ligand is CHEMBL393746. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL393746 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | CN(Cc1cc(cc(c1)C(F)(F)F)C(F)(F)F)C(=O)[C@H]2CN(C[C@@H]2c3ccccc3)C(=O)c4cnccn4 |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 10020002 008a1600 00100900 10010e10 00000041 00100010 1000c400 22003005 10200880 000809f0 09390000 40029002 0c008802 01100000 00820400 0004010c 08020000 02000003 00000018 00000201 80000100 182d8e00 21004000 81400018 00141800 c0000000 08000000 90000004 04000104 0006081b a0140000 80802600 |