On Target OPRK_HUMAN 0.32624114/CHEMBL198238
For the given ligand D9-1, we have found in our database that, being scored 0.32624114, the most similar ligand is CHEMBL198238. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL198238 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | CCNC(=O)N1CCC(CC1)(c2ccccc2)c3nccn3Cc4ccccc4 |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 0000000a 01801600 00101500 10010e00 00080040 00080000 00000024 20003000 80000900 100818c0 08308008 50018000 00009802 00000000 00030480 000c0084 00000000 06000001 00480048 00010201 a0000100 18058400 21000040 81500418 00010000 c0000000 00000000 10000100 04000004 00c6080b 600c0000 20000600 |