On Target NPY4R_HUMAN 0.30857143/CHEMBL2440191
For the given ligand D9-1, we have found in our database that, being scored 0.30857143, the most similar ligand is CHEMBL2440191. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL2440191 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](Cc2cnc[nH]2)NC(=O)[C@H](CCCNC(=N)N)NC(=O)C)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@H]3CC[C@H]3C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@H]4CC[C@H]4C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc5ccc(O)cc5)C(=O)N |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 04030002 01003608 20100100 05810e10 04000240 00000000 02002020 2000200c 00600b80 00090be2 28308000 5003b800 0e009012 00102811 81020000 001c000c 00000000 0e000001 00000018 40020201 20000d00 382d0620 21000003 93500018 00041800 80000200 40120000 10000100 0c000016 0046001b e0084000 20802600 |