On Target ADA2B_HUMAN 0.26666668/CHEMBL85
For the given ligand D9-1, we have found in our database that, being scored 0.26666668, the most similar ligand is CHEMBL85. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL85 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | CC1=C(CCN2CCC(CC2)c3noc4cc(F)ccc34)C(=O)N5CCCCC5=N1 |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 0000008a 01002a00 001a1100 33054618 000c0222 00104050 01003820 20008410 06420980 900918f0 2830840c 50818800 00009082 02f09040 00020080 200c0804 01008200 86838002 00600008 40800201 84a02104 18210018 21c04041 10780594 00040000 c0010000 20000030 18041185 04204005 01c7820a 40280084 e00026b8 |