On Target CNR1_HUMAN 0.33707866/CHEMBL4109469
For the given ligand D9-1, we have found in our database that, being scored 0.33707866, the most similar ligand is CHEMBL4109469. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL4109469 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | CNC(=O)[C@@H](NC(=O)c1cnc(C2CC2)c(OCC3CC3)n1)C(C)(C)C |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 1401800a 02803018 40500c00 14810d10 84000040 86108104 0000e001 0040b209 10410a00 00090090 012d8000 4004b040 06008082 09102800 51820480 001c250c 08020000 26008002 00400408 00000201 84020060 30038e00 21404000 02008518 00140c00 40000000 08000240 90000004 08000304 00860801 b0004000 a4000202 |