On Target PTAFR_HUMAN 0.22222222/CHEMBL36154
For the given ligand D9-1, we have found in our database that, being scored 0.22222222, the most similar ligand is CHEMBL36154. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL36154 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | Cc1nc2cnccc2n1CCCOC3CCC(O3)c4ccccc4 |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 0000004a 01800000 00104102 10010700 082c0070 0000c000 00009800 08000000 10600900 008818e0 0d10800c 40018000 00001800 00a90000 000e0080 022c100c 08a00000 02000000 10e08000 00000001 c0000120 18008070 21800041 00400010 00000400 c0002000 00088200 34000000 00000204 00460802 40480000 02000480 |